CAS 64987-08-2
:Ethyl 2-amino-4-thiazoleglyoxylate
Description:
Ethyl 2-amino-4-thiazoleglyoxylate, identified by its CAS number 64987-08-2, is a chemical compound that features a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. This compound is characterized by the presence of an ethyl ester group and an amino group, contributing to its reactivity and potential applications in organic synthesis. Ethyl 2-amino-4-thiazoleglyoxylate is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The thiazole moiety is often associated with various pharmacological properties, including antimicrobial and anti-inflammatory effects. As with many organic compounds, handling should be conducted with care, considering safety data and potential hazards. Overall, this compound represents a versatile building block in synthetic chemistry, particularly in the development of novel pharmaceuticals and agrochemicals.
Formula:C7H8N2O3S
InChI:InChI=1/C7H8N2O3S/c1-2-12-6(11)5(10)4-3-13-7(8)9-4/h3H,2H2,1H3,(H2,8,9)
SMILES:CCOC(=O)C(=O)c1csc(=N)[nH]1
Synonyms:- Ethyl 2-(2-aminothiazol-4-yl) glyoxylate
- Eatg
- Ethyl (2-Amino-1,3-Thiazol-4-Yl)(Oxo)Acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Ethyl 2-(2-Amino-4-thiazolyl)-2-oxoacetate
CAS:Formula:C7H8N2O3SPurity:>96.0%(T)(HPLC)Color and Shape:Light yellow to Yellow to Orange powder to crystalMolecular weight:200.21Ethyl 2-(2-aminothiazol-4-yl)-2-oxoacetate
CAS:Formula:C7H8N2O3SPurity:96%Color and Shape:SolidMolecular weight:200.2150Ethyl (2-amino-1,3-thiazol-4-yl)(oxo)acetate
CAS:<p>Ethyl (2-amino-1,3-thiazol-4-yl)(oxo)acetate</p>Formula:C7H8N2O3SPurity:≥95%Color and Shape: yellow powderMolecular weight:200.22g/molEthyl 2-(2-aminothiozole-4-yl)glyoxylate
CAS:Formula:C7H8N2O3SPurity:95.0%Color and Shape:SolidMolecular weight:200.21Ethyl 2-(2-Aminothiazol-4-yl)glyoxylate
CAS:Controlled Product<p>Applications Ethyl 2-(2-Aminothiazol-4-yl)glyoxylate is used in the synthesis of antibacterial compounds. Also used in the synthesis of antiallergic and antiinflammatory agents, as glycolic amide derivatives.<br>References Takasugi, H. et al.: J. Antibio., 36, 846 (1983); Ban, M. et al.: Bioorg. Med. Chem., 6, 1069 (1998);<br></p>Formula:C7H8N2O3SColor and Shape:NeatMolecular weight:200.22





