CymitQuimica logo

CAS 64987-82-2

:

4-[(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)methyl]cyclohexanecarboxylic acid

Description:
4-[(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)methyl]cyclohexanecarboxylic acid, with the CAS number 64987-82-2, is a chemical compound that features a cyclohexane ring substituted with a carboxylic acid group and a pyrrole derivative. This compound is characterized by its unique structural features, including the presence of a pyrrolidine ring that contributes to its reactivity and potential biological activity. The dioxo functionality suggests that it may participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding. The carboxylic acid group enhances its solubility in polar solvents and may influence its interaction with biological systems. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural complexity and potential for biological activity. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the functional groups present in its structure.
Formula:C12H15NO4
InChI:InChI=1S/C12H15NO4/c14-10-5-6-11(15)13(10)7-8-1-3-9(4-2-8)12(16)17/h5-6,8-9H,1-4,7H2,(H,16,17)
InChI key:InChIKey=LQILVUYCDHSGEU-UHFFFAOYSA-N
SMILES:C(N1C(=O)C=CC1=O)C2CCC(C(O)=O)CC2
Synonyms:
  • N-(4-Carboxycyclohexylmethyl)maleimide
  • 4-[(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)methyl]cyclohexanecarboxylic acid
  • Cyclohexanecarboxylic acid, 4-[(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)methyl]-
  • 4-(N-Maleimidomethyl)cyclohexane-1-carboxylic acid
Found 8 products.