CAS 64988-76-7

5-(chloromethyl)-3-cyclohexyl-isoxazole

Description:

5-(Chloromethyl)-3-cyclohexyl-isoxazole is an organic compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of a chloromethyl group indicates that a chlorine atom is attached to a carbon that is also bonded to a methyl group, enhancing its reactivity and potential for further chemical modifications. The cyclohexyl group contributes to the compound's hydrophobic characteristics and may influence its solubility and interaction with biological systems. This compound may exhibit interesting pharmacological properties due to its unique structure, making it a subject of interest in medicinal chemistry. Its CAS number, 64988-76-7, allows for easy identification in chemical databases. As with many organic compounds, its physical properties such as melting point, boiling point, and solubility would depend on the specific conditions and purity of the sample. Overall, 5-(chloromethyl)-3-cyclohexyl-isoxazole represents a versatile scaffold for further chemical exploration and potential applications in various fields.

Formula: C₁₀H₁₄ClNO

InChI: InChI=1/C10H14ClNO/c11-7-9-6-10(12-13-9)8-4-2-1-3-5-8/h6,8H,1-5,7H2

SMILES: C1CCC(CC1)c1cc(CCl)on1

5-(chloromethyl)-3-cyclohexylisoxazole

CAS: 64988-76-7

Formula: C₁₀H₁₄ClNO

Purity: 95.0%

Molecular weight: 199.68

Ref: 10-F309595

5-(Chloromethyl)-3-cyclohexylisoxazole

CAS: 64988-76-7

5-(Chloromethyl)-3-cyclohexylisoxazole is an aliphatic aldehyde. It reacts with aldoximes to form cyclic imines, and then undergoes nucleophilic substitution with sodium hydroxide to produce the corresponding oxime. This reagent can be used for the synthesis of 2-amino-1,3-dioxolane compounds.

Formula: C₁₀H₁₄ClNO

Purity: Min. 95%

Molecular weight: 199.68 g/mol

Ref: 3D-PCA98876