CymitQuimica logo

CAS 6499-11-2

:

({[(3R)-3-methylpiperidin-1-yl]carbothioyl}sulfanyl)acetate

Description:
The chemical substance with the name "({[(3R)-3-methylpiperidin-1-yl]carbothioyl}sulfanyl)acetate" and CAS number 6499-11-2 is a thioester derivative featuring a piperidine ring. This compound is characterized by the presence of a methyl group at the 3-position of the piperidine, which contributes to its stereochemistry and potential biological activity. The thioester functional group, indicated by the carbothioyl and sulfanyl moieties, suggests that this compound may participate in various chemical reactions, including nucleophilic attacks and acyl transfer processes. Additionally, the acetate group implies that it can undergo hydrolysis, leading to the release of acetic acid. The stereochemistry of the piperidine ring may influence the compound's interactions with biological targets, making it of interest in medicinal chemistry. Overall, this compound's unique structure and functional groups may confer specific reactivity and biological properties, warranting further investigation in pharmaceutical applications.
Formula:C9H14NO2S2
InChI:InChI=1/C9H15NO2S2/c1-7-3-2-4-10(5-7)9(13)14-6-8(11)12/h7H,2-6H2,1H3,(H,11,12)/p-1/t7-/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.