CAS 6499-15-6
:4-Morpholinecarbothioic acid hydrazide
Description:
4-Morpholinecarbothioic acid hydrazide is an organic compound characterized by its hydrazide functional group and a morpholine ring, which contributes to its unique chemical properties. This compound typically appears as a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of both hydrophilic and hydrophobic regions in its structure. It is known for its potential applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of various bioactive compounds. The presence of the morpholine moiety may impart specific biological activities, making it of interest in medicinal chemistry. Additionally, 4-Morpholinecarbothioic acid hydrazide may exhibit properties such as moderate stability under standard conditions, but it should be handled with care due to potential reactivity associated with the hydrazide group. As with many chemical substances, safety data sheets should be consulted for handling and storage guidelines to ensure safe use in laboratory or industrial settings.
Formula:C5H11N3OS
InChI:InChI=1/C5H11N3OS/c6-7-5(10)8-1-3-9-4-2-8/h1-4,6H2,(H,7,10)
SMILES:C1COCCN1C(=NN)S
Synonyms:- 4-Morpholinethiocarbonyl hydrazide
- A 182
- 4-Diethyleneoxythiosemicarbazide
- Morpholine-4-Carbothiohydrazide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
N-Aminomorpholine-4-carbothioamide
CAS:Controlled ProductApplications N-aminomorpholine-4-carbothioamide (cas# 6499-15-6) is a useful research chemical.
Formula:C5H11N3OSColor and Shape:NeatMolecular weight:161.22N-Aminomorpholine-4-carbothioamide
CAS:N-Aminomorpholine-4-carbothioamide is a ligand that binds to the carboxylates of chloroform. It is produced by the enzyme subtilisin from the amino acid L-alanine and the compound 2-acetylpyridine. This ligand has been found in microorganisms such as Escherichia coli, Staphylococcus aureus, and Saccharomyces cerevisiae. N-Aminomorpholine-4-carbothioamide has been shown to be an effective inhibitor of yeast growth but not bacterial growth. The molecular weight of this ligand is 226.2 g mol−1 and it is a dimer at room temperature with two molecules linked together by hydrogen bonds.
Formula:C5H11N3OSPurity:Min. 95%Molecular weight:161.23 g/molRef: 3D-GAA49915
Discontinued product


