CAS 650-16-8

bis(2,2,2-trifluoroethyl) ethylphosphonate

Description:

Bis(2,2,2-trifluoroethyl) ethylphosphonate, with the CAS number 650-16-8, is an organophosphorus compound characterized by its phosphonate functional group. This substance features two trifluoroethyl groups attached to a phosphorus atom, which contributes to its unique chemical properties, including high thermal stability and low volatility. The presence of trifluoroethyl groups imparts significant hydrophobicity and lipophilicity, making it less soluble in water but more soluble in organic solvents. This compound is often utilized in various applications, including as a flame retardant and in the synthesis of other chemical intermediates. Its structure allows for potential interactions with biological systems, which necessitates careful handling due to possible toxicity. Additionally, the compound's stability under various conditions makes it suitable for use in diverse industrial processes. Overall, bis(2,2,2-trifluoroethyl) ethylphosphonate exemplifies the unique properties of organophosphorus compounds, combining both functional versatility and specific reactivity.

Formula: C₆H₉F₆O₃P

InChI: InChI=1/C6H9F6O3P/c1-2-16(13,14-3-5(7,8)9)15-4-6(10,11)12/h2-4H2,1H3

SMILES: CCP(=O)(OCC(F)(F)F)OCC(F)(F)F

Bis-trifluoromethyl ethylphosphonate

Controlled Product

CAS: 650-16-8

Bis-trifluoromethyl ethylphosphonate is a trivalent, cyclic, scientific device that has been used as an additive to graphene oxide. Voltammetric studies have shown that this compound has a high flammability limit and can be used as a rechargeable battery electrode. The chemical's pentavalent form exhibits densities of 1.65 g/cm3 and 2.25 g/cm3 at 20 °C and 0 °C respectively. Bis-trifluoromethyl ethylphosphonate is used in research for its ability to form tervalent bonds with many other elements, including carbon, nitrogen, oxygen and sulfur.

Formula: C₆H₉F₆O₃P

Purity: Min. 95%

Molecular weight: 274.1 g/mol

Ref: 3D-FB18837