CAS 6500-63-6
:(2Z,4E)-5-(3-methoxyphenyl)penta-2,4-dienoic acid
Description:
(2Z,4E)-5-(3-methoxyphenyl)penta-2,4-dienoic acid, with the CAS number 6500-63-6, is an organic compound characterized by its unique structure featuring a conjugated diene system and a phenyl group substituted with a methoxy group. This compound typically exhibits properties associated with unsaturated fatty acids, including potential reactivity due to the presence of double bonds. The methoxy group enhances its solubility in organic solvents and may influence its biological activity. The geometric isomerism indicated by the (2Z,4E) notation suggests specific spatial arrangements around the double bonds, which can affect the compound's reactivity and interactions with biological systems. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. Additionally, the presence of the carboxylic acid functional group contributes to its acidity and potential for forming salts or esters, further expanding its utility in various chemical reactions.
Formula:C12H12O3
InChI:InChI=1/C12H12O3/c1-15-11-7-4-6-10(9-11)5-2-3-8-12(13)14/h2-9H,1H3,(H,13,14)/b5-2+,8-3-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
