CymitQuimica logo

CAS 65017-97-2

:

(3aR,7aS,8S,9aS)-3a,7,7a,8,9,9a-Hexahydro-5,8-dimethyl-3-methyleneazuleno[6,5-b]furan-2,6(3H,4H)-dione

Description:
The chemical substance known as (3aR,7aS,8S,9aS)-3a,7,7a,8,9,9a-Hexahydro-5,8-dimethyl-3-methyleneazuleno[6,5-b]furan-2,6(3H,4H)-dione, with the CAS number 65017-97-2, is a complex organic compound characterized by its unique bicyclic structure that incorporates both furan and azulene moieties. This compound features multiple stereocenters, which contribute to its specific three-dimensional configuration and potentially influence its biological activity. The presence of the dimethyl and methylene groups suggests that it may exhibit hydrophobic properties, affecting its solubility and interaction with biological membranes. Additionally, the dione functional groups indicate potential reactivity, allowing for various chemical transformations. Such compounds are often of interest in medicinal chemistry and natural product synthesis due to their structural complexity and potential pharmacological properties. However, detailed studies on its specific biological activity, stability, and reactivity would be necessary to fully understand its applications and implications in various fields.
Formula:C15H18O3
InChI:InChI=1S/C15H18O3/c1-7-4-14-12(9(3)15(17)18-14)5-11-8(2)13(16)6-10(7)11/h7,10,12,14H,3-6H2,1-2H3/t7-,10-,12+,14-/m0/s1
InChI key:InChIKey=UQNONRHPSCIIJO-BNYHBGRESA-N
SMILES:CC1=C2[C@]([C@@H](C)C[C@]3([C@](C2)(C(=C)C(=O)O3)[H])[H])(CC1=O)[H]
Synonyms:
  • Xerantholide
  • Azuleno[6,5-b]furan-2,6(3H,4H)-dione, 3a,7,7a,8,9,9a-hexahydro-5,8-dimethyl-3-methylene-, [3aR-(3aα,7aα,8β,9aβ)]-
  • (3aR,7aS,8S,9aS)-3a,7,7a,8,9,9a-Hexahydro-5,8-dimethyl-3-methyleneazuleno[6,5-b]furan-2,6(3H,4H)-dione
  • Azuleno[6,5-b]furan-2,6(3H,4H)-dione, 3a,7,7a,8,9,9a-hexahydro-5,8-dimethyl-3-methylene-, (3aR,7aS,8S,9aS)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.