CAS 65033-20-7

1-[4-hydroxy-3-(methoxymethyl)phenyl]ethanone

Description:

1-[4-Hydroxy-3-(methoxymethyl)phenyl]ethanone, also known by its CAS number 65033-20-7, is an organic compound characterized by its phenolic structure. It features a hydroxyl group (-OH) and a methoxymethyl group (-OCH2-), which contribute to its chemical reactivity and solubility properties. The presence of the ethanone functional group (ketone) indicates that it has a carbonyl group (C=O) adjacent to the aromatic ring, which can influence its reactivity in various chemical reactions, such as nucleophilic additions. This compound is likely to exhibit moderate polarity due to the hydroxyl and methoxy groups, making it soluble in polar solvents like alcohols and water to some extent. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. However, specific properties such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise characterization.

Formula: C₁₀H₁₂O₃

InChI: InChI=1/C10H12O3/c1-7(11)8-3-4-10(12)9(5-8)6-13-2/h3-5,12H,6H2,1-2H3

SMILES: CC(=O)c1ccc(c(c1)COC)O

Synonyms:

• 1-(4-Hydroxy-3-methoxymethyl-phenyl)-ethanone

1-[4-Hydroxy-3-(methoxymethyl)phenyl]ethan-1-one

CAS: 65033-20-7

Versatile small molecule scaffold

Formula: C₁₀H₁₂O₃

Purity: Min. 95%

Molecular weight: 180.2 g/mol

Ref: 3D-QCA03320