CAS 65035-34-9
:(+)-Lineatin
Description:
(+)-Lineatin, with the CAS number 65035-34-9, is a naturally occurring chemical compound classified as a sesquiterpene. It is primarily derived from certain plant sources and is known for its unique structural features, which include multiple chiral centers contributing to its optical activity. This compound exhibits a characteristic sweet, floral aroma, making it of interest in the fragrance and flavor industries. Additionally, (+)-Lineatin has been studied for its potential biological activities, including antimicrobial and anti-inflammatory properties, although further research is needed to fully understand its mechanisms and applications. Its solubility properties typically align with those of other sesquiterpenes, being more soluble in organic solvents than in water. As with many natural products, the extraction and purification processes can influence its yield and purity, which are critical for both research and commercial applications. Overall, (+)-Lineatin represents a fascinating area of study within the realm of natural products chemistry.
Formula:C10H16O2
InChI:InChI=1S/C10H16O2/c1-9(2)8-6-4-10(8,3)5-7(11-6)12-9/h6-8H,4-5H2,1-3H3/t6-,7-,8+,10-/m1/s1
InChI key:InChIKey=SHTFZHTWSLHVEB-BDNRQGISSA-N
SMILES:C[C@@]12[C@]3([C@@](C1)(O[C@@](C2)(O[C@@]3(C)C)[H])[H])[H]
Synonyms:- (+/-)-3,3,7-Trimethyl-2,9-dioxatricyclo[3.3.1.04,7]nonane
- (1R,2S,5R,7R)-1,3,3-Trimethyl-4,6-dioxatricyclo[3.3.1.0<sup>2,7</sup>]nonane
- (1R,2S,5R,7R)-1,3,3-trimethyl-4,6-dioxatricyclo[3.3.1.0~2,7~]nonane
- 4,6-Dioxatricyclo[3.3.1.0<sup>2,7</sup>]nonane, 1,3,3-trimethyl-, (1R)-
- 4,6-Dioxatricyclo[3.3.1.0<sup>2,7</sup>]nonane, 1,3,3-trimethyl-, (1R,2S,5R,7R)-
- (+)-Lineatin
- (1R,2S,5R,7R)-1,3,3-Trimethyl-4,6-dioxatricyclo[3.3.1.02,7]nonane
- 4,6-Dioxatricyclo[3.3.1.02,7]nonane, 1,3,3-trimethyl-, (1R)-
- Lineatin
- 4,6-Dioxatricyclo[3.3.1.02,7]nonane, 1,3,3-trimethyl-, (1R,2S,5R,7R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lineatin
CAS:Lineatin, a pheromone from female ambrosia beetle frass, harms conifer forests in Europe, North America.Formula:C10H16O2Color and Shape:SolidMolecular weight:168.23
