CymitQuimica logo

CAS 65038-36-0

:

1,4-bis(dicyclohexylphosphino)butane

Description:
1,4-Bis(dicyclohexylphosphino)butane, commonly referred to as DCPB, is a bidentate ligand widely used in coordination chemistry and catalysis. It features a butane backbone with two dicyclohexylphosphino groups attached at the 1 and 4 positions, which enhances its ability to chelate metal centers. This compound is characterized by its relatively high molecular weight and significant steric bulk due to the dicyclohexyl groups, which can influence the reactivity and selectivity of metal complexes. DCPB is known for its strong electron-donating properties, making it effective in stabilizing low-valent metal complexes. It is often employed in palladium-catalyzed cross-coupling reactions, such as Suzuki and Heck reactions, due to its ability to facilitate the formation of stable intermediates. Additionally, the ligand's solubility in organic solvents and thermal stability make it suitable for various synthetic applications. Safety precautions should be observed when handling this compound, as with many organophosphorus compounds, due to potential toxicity and environmental concerns.
Formula:C28H52P2
InChI:InChI=1/C28H52P2/c1-5-15-25(16-6-1)29(26-17-7-2-8-18-26)23-13-14-24-30(27-19-9-3-10-20-27)28-21-11-4-12-22-28/h25-28H,1-24H2
InChI key:WNZGLXFLSFWPMP-UHFFFAOYSA-N
SMILES:C1CCC(CC1)P(CCCCP(C1CCCCC1)C1CCCCC1)C1CCCCC1
Synonyms:
  • Butane-1,4-Diylbis(Dicyclohexylphosphane)
Found 4 products.