CAS 65039-74-9

Spinatoside

Description:

Spinatoside, with the CAS number 65039-74-9, is a chemical compound that belongs to the class of glycosides. It is derived from natural sources, particularly from certain plant species, and is known for its potential biological activities. Spinatoside typically exhibits properties such as antioxidant and anti-inflammatory effects, which have garnered interest in pharmacological research. The compound is characterized by its glycosidic bond, linking a sugar moiety to a non-sugar aglycone, which contributes to its solubility and reactivity. Its structure may influence its interaction with biological systems, making it a subject of study for potential therapeutic applications. Additionally, spinatoside may be involved in various metabolic pathways within the organisms from which it is derived. As with many natural products, the specific characteristics, including its stability, solubility, and reactivity, can vary based on environmental conditions and the presence of other compounds. Further research is often necessary to fully elucidate its mechanisms of action and potential uses in medicine or industry.

Formula: C₂₃H₂₂O₁₄

InChI: InChI=1S/C23H22O14/c1-33-19-9(25)6-11-12(13(19)26)14(27)20(34-2)18(35-11)7-3-4-10(8(24)5-7)36-23-17(30)15(28)16(29)21(37-23)22(31)32/h3-6,15-17,21,23-26,28-30H,1-2H3,(H,31,32)/t15-,16-,17+,21-,23+/m0/s1

InChI key: InChIKey=YIDAQAJEKNRLJS-QJAHINBCSA-N

SMILES: O=C1C=2C(OC(=C1OC)C3=CC(O)=C(O[C@@H]4O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]4O)C=C3)=CC(O)=C(OC)C2O

Synonyms:

• 4-(5,7-Dihydroxy-3,6-dimethoxy-4-oxo-4H-1-benzopyran-2-yl)-2-hydroxyphenyl β-D-glucopyranosiduronic acid
• β-D-Glucopyranosiduronic acid, 4-(5,7-dihydroxy-3,6-dimethoxy-4-oxo-4H-1-benzopyran-2-yl)-2-hydroxyphenyl
• Spinatoside

Axillarin 4'-glucuronide

CAS: 65039-74-9

Axillarin 4'-glucuronide is a useful organic compound for research related to life sciences. The catalog number is T124474 and the CAS number is 65039-74-9.

Formula: C₂₃H₂₂O₁₄

Color and Shape: Solid

Molecular weight: 522.415

Ref: TM-T124474