CAS 6504-13-8

4-(1H-benzimidazol-2-yl)phenol

Description:

4-(1H-benzimidazol-2-yl)phenol, with the CAS number 6504-13-8, is an organic compound characterized by its structure, which includes a phenolic group and a benzimidazole moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in pharmaceuticals and materials science due to its biological activity and ability to form coordination complexes. It is known for its antioxidant properties and may exhibit antimicrobial or antifungal activities, making it of interest in medicinal chemistry. The presence of both the phenolic and benzimidazole groups contributes to its chemical reactivity, allowing for various substitution reactions. Additionally, it may display solubility in organic solvents, while its solubility in water can vary depending on pH and other conditions. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use. Overall, 4-(1H-benzimidazol-2-yl)phenol is a compound of interest in various fields of research and application.

Formula: C₁₃H₁₀N₂O

InChI: InChI=1/C13H10N2O/c16-10-7-5-9(6-8-10)13-14-11-3-1-2-4-12(11)15-13/h1-8,16H,(H,14,15)

SMILES: c1ccc2c(c1)[nH]c(c1ccc(cc1)O)n2

Synonyms:

• Phenol, 4-(1H-benzimidazol-2-yl)-

4-(1H-BENZOIMIDAZOL-2-YL)-PHENOL

CAS: 6504-13-8

Formula: C₁₃H₁₀N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 210.2313

Ref: IN-DA00EJAD

4-(1H-Benzo[d]imidazol-2-yl)phenol

CAS: 6504-13-8

4-(1H-Benzo[d]imidazol-2-yl)phenol

Purity: 98%

Molecular weight: 210.23g/mol

Ref: 54-OR93776

4-(1H-benzimidazol-2-yl)phenol

CAS: 6504-13-8

Purity: 95.0%

Color and Shape: Solid, White powder

Molecular weight: 210.23599243164062

Ref: 10-F313785

4-(1H-Benzo[d]imidazol-2-yl)phenol

CAS: 6504-13-8

Formula: C₁₃H₁₀N₂O

Purity: >95.0%(T)(HPLC)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 210.24

Ref: 3B-H1875

4-(1H-Benzo[D]imidazol-2-yl)phenol hydrochloride

CAS: 6504-13-8

Versatile small molecule scaffold

Formula: C₁₃H₁₀N₂O

Purity: Min. 95%

Molecular weight: 210.23 g/mol

Ref: 3D-GAA50413