CAS 65049-45-8

Pregna-1,4-diene-3,20-dione, 9,11-dichloro-21-hydroxy-16-methyl-, (11β,16α)-

Description:

Pregna-1,4-diene-3,20-dione, 9,11-dichloro-21-hydroxy-16-methyl-, (11β,16α)-, commonly known as a synthetic steroid, exhibits several notable characteristics. This compound is a derivative of progesterone and is classified as a glucocorticoid, which means it has anti-inflammatory and immunosuppressive properties. Its structure includes multiple functional groups, such as hydroxyl and carbonyl groups, which contribute to its biological activity. The presence of chlorine atoms in its structure enhances its potency and alters its pharmacokinetic properties. This compound is often utilized in medical applications, particularly in hormone replacement therapy and in the treatment of various inflammatory conditions. Its mechanism of action typically involves binding to glucocorticoid receptors, leading to modulation of gene expression and subsequent physiological effects. Additionally, due to its synthetic nature, it may exhibit different metabolic pathways compared to naturally occurring steroids, influencing its efficacy and safety profile. Overall, this compound is significant in both pharmaceutical research and clinical applications.

Formula: C₂₂H₂₈Cl₂O₃

InChI: InChI=1S/C22H28Cl2O3/c1-12-8-16-15-5-4-13-9-14(26)6-7-21(13,3)22(15,24)18(23)10-20(16,2)19(12)17(27)11-25/h6-7,9,12,15-16,18-19,25H,4-5,8,10-11H2,1-3H3/t12-,15+,16+,18+,19-,20+,21+,22+/m1/s1

InChI key: InChIKey=FKRMBGXNTOTQDI-IIEHVVJPSA-N

SMILES: Cl[C@@]12[C@]([C@]3([C@](C)(C[C@@H]1Cl)[C@@H](C(CO)=O)[C@H](C)C3)[H])(CCC=4[C@]2(C)C=CC(=O)C4)[H]

Synonyms:

• Pregna-1,4-diene-3,20-dione, 9,11-dichloro-21-hydroxy-16-methyl-, (11β,16α)-
• RU 24476

Locicortolone

CAS: 65049-45-8

Locicortolone is a synthetic glucocorticoid corticosteroid which was never marketed.

Formula: C₂₂H₂₈Cl₂O₃

Color and Shape: Solid

Molecular weight: 411.36

Ref: TM-T32838