CAS 65051-24-3

[(4-fluorobenzyl)sulfanyl]acetic acid

Description:

[(4-Fluorobenzyl)sulfanyl]acetic acid is an organic compound characterized by the presence of a sulfanyl (thioether) functional group and a carboxylic acid group. The compound features a 4-fluorobenzyl moiety, which contributes to its aromatic properties and potential reactivity. The presence of the fluorine atom can influence the compound's electronic properties, making it more polar and potentially enhancing its biological activity. The sulfanyl group introduces sulfur into the structure, which can affect the compound's solubility and reactivity, particularly in nucleophilic substitution reactions. As a carboxylic acid, it exhibits acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The compound may also exhibit interesting pharmacological properties due to its unique structure, making it a candidate for further research in medicinal chemistry. Overall, [(4-fluorobenzyl)sulfanyl]acetic acid is a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₉H₉FO₂S

InChI: InChI=1/C9H9FO2S/c10-8-3-1-7(2-4-8)5-13-6-9(11)12/h1-4H,5-6H2,(H,11,12)

SMILES: c1cc(ccc1CSCC(=O)O)F

Synonyms:

• Acetic Acid, 2-[[(4-Fluorophenyl)Methyl]Thio]-

[(4-fluorobenzyl)thio]acetic acid

CAS: 65051-24-3

Formula: C₉H₉FO₂S

Molecular weight: 200.23

Ref: 10-F346568