CAS 65055-17-6

3-Chloro-4-fluorobenzoyl chloride

Description:

3-Chloro-4-fluorobenzoyl chloride is an organic compound characterized by its aromatic structure, which includes a benzoyl group substituted with both chlorine and fluorine atoms. This compound features a carbonyl group (C=O) adjacent to a chlorine atom at the meta position and a fluorine atom at the para position relative to the carbonyl group. It is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. The presence of the acyl chloride functional group makes it highly reactive, particularly with nucleophiles, which can lead to the formation of various derivatives. This compound is often used in organic synthesis, particularly in the preparation of pharmaceuticals and agrochemicals. Its reactivity and specific substituents can influence its behavior in chemical reactions, making it a valuable intermediate in synthetic chemistry. Additionally, safety precautions should be taken when handling this compound due to its corrosive nature and potential health hazards associated with exposure.

Formula: C₇H₃Cl₂FO

InChI: InChI=1/C7H3Cl2FO/c8-5-3-4(7(9)11)1-2-6(5)10/h1-3H

SMILES: c1cc(c(cc1C(=O)Cl)Cl)F

Synonyms:

• 65055-17-6
• Gvr Cg Df

3-Chloro-4-fluorobenzoyl Chloride

CAS: 65055-17-6

Formula: C₇H₃Cl₂FO

Purity: >98.0%(GC)(T)

Color and Shape: Colorless to Light yellow clear liquid

Molecular weight: 193.00

Ref: 3B-C2122

3-Chloro-4-fluorobenzoyl chloride

CAS: 65055-17-6

Formula: C₇H₃Cl₂FO

Purity: 97%

Color and Shape: Liquid

Molecular weight: 193.0025

Ref: IN-DA003J81

3-Chloro-4-fluorobenzoyl chloride

CAS: 65055-17-6

3-Chloro-4-fluorobenzoyl chloride

Purity: 98%

Color and Shape: Yellow Liquid

Molecular weight: 193.00g/mol

Ref: 54-PC4308

3-Chloro-4-fluorobenzoyl chloride

CAS: 65055-17-6

Formula: C₇H₃Cl₂FO

Purity: 97.0%

Color and Shape: Low Melting Solid

Molecular weight: 193

Ref: 10-F007836

3-Chloro-4-fluorobenzoyl chloride

CAS: 65055-17-6

3-Chloro-4-fluorobenzoyl chloride is a chlorinating agent that is used as a fungicide, phytotoxin, and an insecticide. It is an effective pesticide against many fungal diseases that affect plants. 3-Chloro-4-fluorobenzoyl chloride has been shown to be effective in the treatment of cervical cancer and other cancers. It also has photochromic properties, which make it useful for detecting skin cancer. 3-Chloro-4-fluorobenzoyl chloride is synthesized by reacting chlorine with 4-fluorobenzoyl chloride in the presence of a base such as sodium hydroxide or potassium hydroxide. This reaction can be carried out in either liquid or gaseous phases. The product can be purified by vacuum distillation or crystallization. 3-Chloro-4-fluorobenzoyl chloride is primarily used as a fungicide

Formula: C₇H₃Cl₂FO

Purity: Min. 95%

Molecular weight: 193 g/mol

Ref: 3D-FC64270