CAS 6506-32-7

α,5-Dimethyl-4-isoxazolemethanol

Description:

α,5-Dimethyl-4-isoxazolemethanol, with the CAS number 6506-32-7, is a chemical compound characterized by its isoxazole ring structure, which contributes to its unique properties. This compound features a hydroxymethyl group and two methyl groups at the 2 and 5 positions of the isoxazole ring, influencing its reactivity and solubility. Typically, isoxazole derivatives exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The presence of the hydroxymethyl group may enhance its potential for hydrogen bonding, affecting its interactions with biological targets. Additionally, the compound's stability and solubility in various solvents can vary based on the functional groups present. While specific applications may depend on further research, compounds of this nature are often explored for their potential use in agrochemicals, pharmaceuticals, or as intermediates in organic synthesis. As with any chemical substance, safety data and handling precautions should be consulted to ensure proper use and minimize risks.

Formula: C₆H₉NO₂

InChI: InChI=1S/C6H9NO2/c1-4(8)6-3-7-9-5(6)2/h3-4,8H,1-2H3

InChI key: InChIKey=QHSPNNPWVCTCSL-UHFFFAOYSA-N

SMILES: C(C)(O)C1=C(C)ON=C1

Synonyms:

• 4-Isoxazolemethanol, α,5-dimethyl-
• 1-(5-Methyl-1,2-oxazol-4-yl)ethan-1-ol
• α,5-Dimethyl-4-isoxazolemethanol

1-(5-Methyl-1,2-oxazol-4-yl)ethan-1-ol

CAS: 6506-32-7

Versatile small molecule scaffold

Formula: C₆H₉NO₂

Purity: Min. 95%

Molecular weight: 127.14 g/mol

Ref: 3D-GAA50632