CAS 650635-00-0
:6-(3,4-Dichlorophenyl)-3(2H)-pyridazinethione
Description:
6-(3,4-Dichlorophenyl)-3(2H)-pyridazinethione is a chemical compound characterized by its unique structure, which includes a pyridazine ring fused with a thione functional group and substituted with a dichlorophenyl moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, which may include antimicrobial or anti-inflammatory effects, although specific biological data would depend on empirical studies. The presence of the dichlorophenyl group suggests that it may have enhanced lipophilicity, potentially influencing its solubility and permeability in biological systems. Additionally, the thione functional group can participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. The compound's stability, reactivity, and potential applications in pharmaceuticals or agrochemicals would be influenced by its molecular structure and the electronic effects of the substituents. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or environmental impact.
Formula:C10H6Cl2N2S
InChI:InChI=1S/C10H6Cl2N2S/c11-7-2-1-6(5-8(7)12)9-3-4-10(15)14-13-9/h1-5H,(H,14,15)
InChI key:InChIKey=DZFVCHNSCQSAGK-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1Cl)C=2C=CC(=S)NN2
Synonyms:- 3(2H)-Pyridazinethione, 6-(3,4-dichlorophenyl)-
- 6-(3,4-Dichlorophenyl)-3(2H)-pyridazinethione
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery