CymitQuimica logo

CAS 650638-07-6

:

1H-Pyrazolo[3,4-d]pyrimidine, 4-chloro-1-(4-pyridinyl)-

Description:
1H-Pyrazolo[3,4-d]pyrimidine, 4-chloro-1-(4-pyridinyl)- is a heterocyclic compound characterized by its fused pyrazole and pyrimidine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 4-position and a pyridinyl group at the 1-position enhances its reactivity and potential biological activity. This compound typically exhibits moderate to high solubility in polar organic solvents, which is influenced by the functional groups present. It may display various pharmacological activities, making it of interest in medicinal chemistry, particularly in the development of novel therapeutic agents. The molecular structure allows for potential interactions with biological targets, and its synthesis often involves multi-step organic reactions. As with many heterocycles, it may also exhibit interesting electronic properties due to the delocalization of electrons within its aromatic systems. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C10H6ClN5
InChI:InChI=1S/C10H6ClN5/c11-9-8-5-15-16(10(8)14-6-13-9)7-1-3-12-4-2-7/h1-6H
InChI key:UZZXPEHPJSVCQJ-UHFFFAOYSA-N
SMILES:C1=CN=CC=C1N2C3=C(C=N2)C(=NC=N3)Cl
Found 4 products.