CymitQuimica logo

CAS 65064-83-7

:

2-chloro-1,1,2-trifluoroethyl 2,2,3,3-tetrafluoropropyl ether

Description:
2-Chloro-1,1,2-trifluoroethyl 2,2,3,3-tetrafluoropropyl ether, with the CAS number 65064-83-7, is a fluorinated organic compound characterized by its unique structure that includes both chlorine and multiple fluorine atoms. This compound typically appears as a colorless liquid and is known for its low volatility and high stability, which are common traits of fluorinated ethers. It exhibits low solubility in water but is soluble in organic solvents, making it useful in various applications, including as a solvent or intermediate in chemical synthesis. The presence of fluorine atoms imparts significant chemical inertness and thermal stability, while the chlorine atom can influence reactivity and potential applications in organic synthesis. Additionally, due to its fluorinated nature, this compound may have specific environmental and health considerations, necessitating careful handling and assessment of its properties in industrial or laboratory settings. Overall, 2-chloro-1,1,2-trifluoroethyl 2,2,3,3-tetrafluoropropyl ether is notable for its unique chemical characteristics and potential utility in specialized applications.
Formula:C5H4ClF7O
InChI:InChI=1/C5H4ClF7O/c6-2(7)5(12,13)14-1-4(10,11)3(8)9/h2-3H,1H2
SMILES:C(C(C(F)F)(F)F)OC(C(Cl)F)(F)F
Synonyms:
  • 3-(2-Chloro-1,1,2-trifluoroethoxy)-1,1,2,2-tetrafluoropropane
  • Propane, 3-(2-Chloro-1,1,2-Trifluoroethoxy)-1,1,2,2-Tetrafluoro-
  • 2-Chloro-1,1,2-trifluoroethyl 2,2,3,3-tetrafluoropropyl ether
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.