CAS 65069-52-5

1-(3,4-dimethoxyphenyl)thiourea

Description:

1-(3,4-Dimethoxyphenyl)thiourea is an organic compound characterized by the presence of a thiourea functional group attached to a substituted phenyl ring. The molecular structure features two methoxy groups (-OCH3) located at the 3 and 4 positions of the phenyl ring, which influence its electronic properties and solubility. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO), but may have limited solubility in water due to its hydrophobic aromatic components. 1-(3,4-Dimethoxyphenyl)thiourea is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and applications in synthesizing other chemical entities. Its reactivity can be attributed to the thiourea moiety, which can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Safety data should be consulted for handling and usage, as with all chemical substances.

Formula: C₉H₁₂N₂O₂S

InChI: InChI=1/C9H12N2O2S/c1-12-7-4-3-6(11-9(10)14)5-8(7)13-2/h3-5H,1-2H3,(H3,10,11,14)

SMILES: COc1ccc(cc1OC)NC(=N)S

(3,4-Dimethoxyphenyl)thiourea

CAS: 65069-52-5

Versatile small molecule scaffold

Formula: C₉H₁₂N₂O₂S

Purity: Min. 95%

Molecular weight: 212.27 g/mol

Ref: 3D-QCA06952