CAS 65072-48-2
:3,4-Dichloro-α,α-bis(trifluoromethyl)benzenemethanol
Description:
3,4-Dichloro-α,α-bis(trifluoromethyl)benzenemethanol, with the CAS number 65072-48-2, is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with two chlorine atoms and two trifluoromethyl groups, along with a hydroxymethyl group. This compound is typically a solid at room temperature and exhibits significant hydrophobic properties due to the presence of the trifluoromethyl groups, which can influence its solubility and reactivity. The dichloro and trifluoromethyl substitutions contribute to its potential applications in various fields, including agrochemicals and pharmaceuticals, as they can enhance biological activity and stability. Additionally, the presence of the hydroxymethyl group may provide sites for further chemical modifications. Safety data should be consulted, as halogenated compounds can exhibit toxicity and environmental persistence. Overall, 3,4-Dichloro-α,α-bis(trifluoromethyl)benzenemethanol is a notable compound in organic chemistry with unique properties stemming from its specific functional groups and molecular structure.
Formula:C9H4Cl2F6O
InChI:InChI=1/C9H4Cl2F6O/c10-5-2-1-4(3-6(5)11)7(18,8(12,13)14)9(15,16)17/h1-3,18H
InChI key:InChIKey=JCCWOKZXPBZZBV-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(C(F)(F)F)(O)C1=CC(Cl)=C(Cl)C=C1
Synonyms:- 2-(3,4-Dichlorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol
- 2-(3,4-Dichlorophenyl)-1,1,1,3,3,3-hexafluoro-propan-2-ol
- Benzenemethanol, 3,4-dichloro-α,α-bis(trifluoromethyl)-
- 3,4-Dichloro-α,α-bis(trifluoromethyl)benzenemethanol
- benzenemethanol, 3,4-dichloro-alpha,alpha-bis(trifluoromethyl)-
- Benzyl alcohol, 3,4-dichloro-alpha,alpha-bis(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(3,4-Dichlorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol
CAS:Formula:C9H4Cl2F6OMolecular weight:313.0239
