CAS 65100-04-1

Methacryloxypropylmethyldiethoxysilane

Description:

Methacryloxypropylmethyldiethoxysilane, with the CAS number 65100-04-1, is a silane coupling agent that features both methacrylate and silane functional groups. This compound is characterized by its ability to bond organic materials to inorganic surfaces, making it valuable in various applications, particularly in the fields of adhesives, coatings, and composites. It typically appears as a clear to slightly yellow liquid and has a moderate viscosity. The presence of the methacrylate group allows for polymerization, enabling it to form cross-linked networks when exposed to heat or UV light, which enhances the mechanical properties of the resulting materials. Additionally, the ethoxy groups contribute to its reactivity and compatibility with different substrates. Methacryloxypropylmethyldiethoxysilane is known for improving adhesion, water resistance, and durability in formulations, making it a crucial component in the development of advanced materials in industries such as construction, automotive, and electronics. Proper handling and storage are essential due to its reactive nature and potential health hazards.

Formula: C₁₂H₂₄O₄Si

InChI: InChI=1/C12H24O4Si/c1-6-15-17(5,16-7-2)10-8-9-14-12(13)11(3)4/h3,6-10H2,1-2,4-5H3

SMILES: CCO[Si](C)(CCCOC(=O)C(=C)C)OCC

Synonyms:

• 3-(Methyldiethoxysilyl)Propyl Metha-Crylate
• 3-(Diethoxymethylsilyl)propyl methacrylate
• 3-Methacryloxypropylmethyldiethoxysilane
• 3-[Diethoxy(Methyl)Silyl]Propyl 2-Methylprop-2-Enoate

3-(Diethoxy(Methyl)Silyl)Propyl Methacrylate

CAS: 65100-04-1

3-(Diethoxy(Methyl)Silyl)Propyl Methacrylate

Purity: 98%

Molecular weight: 260.40g/mol

Ref: 54-OR1010694

3-[Diethoxy(methyl)silyl]propyl Methacrylate

CAS: 65100-04-1

Formula: C₁₂H₂₄O₄Si

Purity: >98.0%(GC)

Color and Shape: Colorless to Almost colorless clear liquid

Molecular weight: 260.41

Ref: 3B-D4679

3-[Diethoxy(methyl)silyl]propyl methacrylate

CAS: 65100-04-1

3-[Diethoxy(methyl)silyl]propyl Methacrylate is a chelating agent that is used as a coating on metal surfaces to prevent corrosion. It is also used as a polymerization initiator in the production of polymers and coatings. This compound is able to cross-link molecules and form stable bonds with metal surfaces. 3-[Diethoxy(methyl)silyl]propyl Methacrylate has the ability to adsorb water vapor, which helps to keep the surface dry and free from corrosion. It also has optical properties that are sensitive to light, allowing it to be used for chromatographic purposes. The hydroxy group on this molecule can be converted into an acid or ester, which allows it to react with other compounds.

Formula: C₁₂H₂₄O₄Si

Purity: Min. 95%

Color and Shape: Clear Liquid

Molecular weight: 260.41 g/mol

Ref: 3D-QCA10004