CAS 651004-99-8

2-{4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl}ethanol

Description:

2-{4-[4-(Trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl}ethanol is a chemical compound characterized by its complex structure, which includes a piperazine ring and a pyrimidine moiety, along with a trifluoromethyl group. This compound features a hydroxyl (-OH) group, indicating it is an alcohol, which contributes to its solubility in polar solvents. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The piperazine ring is known for its role in various pharmacological agents, often contributing to the modulation of neurotransmitter systems. The compound's molecular structure suggests potential applications in drug development, particularly in targeting specific receptors or enzymes. Its unique combination of functional groups may also impart specific reactivity and stability characteristics, making it suitable for further chemical modifications or as a lead compound in therapeutic research. Overall, this compound exemplifies the intricate design often found in pharmaceutical chemistry, where structural features are tailored for desired biological effects.

Formula: C₁₁H₁₅F₃N₄O

InChI: InChI=1/C11H15F3N4O/c12-11(13,14)9-1-2-15-10(16-9)18-5-3-17(4-6-18)7-8-19/h1-2,19H,3-8H2

SMILES: c1cnc(nc1C(F)(F)F)N1CCN(CC1)CCO

Synonyms:

• 1-(2-Hydroxyethyl)-4-(4-trifluoromethylpyrimidin-2-yl)piperazine
• 1-Piperazineethanol, 4-[4-(Trifluoromethyl)-2-Pyrimidinyl]-
• 2-{4-[4-(Trifluoromethyl)Pyrimidin-2-Yl]Piperazino}Ethan-1-Ol
• 2-{4-[4-(Trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl}ethanol

2-{4-[4-(Trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl}ethanol

CAS: 651004-99-8

2-{4-[4-(Trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl}ethanol

Purity: ≥95%

Molecular weight: 276.26g/mol

Ref: 54-PC300683