CAS 651027-01-9

2-bromo-3,5-difluorobenzoic acid

Description:

2-Bromo-3,5-difluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and two fluorine atoms on a benzene ring, specifically at the 2, 3, and 5 positions relative to the carboxylic acid group. This compound typically appears as a solid at room temperature and is soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the aromatic ring and the presence of halogen substituents. The presence of electronegative halogens like bromine and fluorine can significantly influence the compound's reactivity, acidity, and overall chemical behavior, often enhancing its electrophilic character. 2-Bromo-3,5-difluorobenzoic acid may be utilized in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals, due to its unique structural features. Additionally, its derivatives can exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Safety precautions should be observed when handling this compound, as halogenated compounds can pose health risks.

Formula: C₇H₃BrF₂O₂

InChI: InChI=1/C7H3BrF2O2/c8-6-4(7(11)12)1-3(9)2-5(6)10/h1-2H,(H,11,12)

SMILES: c1c(cc(c(c1C(=O)O)Br)F)F

Synonyms:

• Benzoic Acid, 2-Bromo-3,5-Difluoro-

2-Bromo-3,5-difluorobenzoic acid

CAS: 651027-01-9

Formula: C₇H₃BrF₂O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 236.9983

Ref: IN-DA0039MO

2-Bromo-3,5-difluorobenzoic acid

CAS: 651027-01-9

2-Bromo-3,5-difluorobenzoic acid

Formula: C₇H₃BrF₂O₂

Purity: ≥95%

Color and Shape: faint beige/ brown crystalline powder

Molecular weight: 237.00g/mol

Ref: 54-PC501854

2-Bromo-3,5-difluorobenzoic acid

CAS: 651027-01-9

Formula: C₇H₃BrF₂O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 237

Ref: 10-F092283