CAS 651042-73-8

4-(1-Isoquinolinyl)-2-thiazolamine

Description:

4-(1-Isoquinolinyl)-2-thiazolamine is a chemical compound characterized by its unique structural features, which include an isoquinoline moiety and a thiazole ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the thiazole ring suggests that it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, the isoquinoline structure is known for its role in medicinal chemistry, often associated with pharmacological activities such as antitumor and antimicrobial effects. The compound's solubility, stability, and reactivity can vary depending on the specific functional groups and substituents present. As with many heterocyclic compounds, it may also exhibit fluorescence properties, making it useful in certain analytical applications. Overall, 4-(1-Isoquinolinyl)-2-thiazolamine represents a class of compounds that are of interest in both synthetic chemistry and drug discovery due to their diverse chemical behavior and potential therapeutic applications.

Formula: C₁₂H₉N₃S

InChI: InChI=1S/C12H9N3S/c13-12-15-10(7-16-12)11-9-4-2-1-3-8(9)5-6-14-11/h1-7H,(H2,13,15)

InChI key: InChIKey=YLNUDNTUPQXQBM-UHFFFAOYSA-N

SMILES: NC1=NC(C=2C3=C(C=CN2)C=CC=C3)=CS1

Synonyms:

• 2-Thiazolamine, 4-(1-isoquinolinyl)-
• 4-(1-Isoquinolinyl)-2-thiazolamine

4-(Isoquinolin-1-yl)-1,3-thiazol-2-amine

CAS: 651042-73-8

Versatile small molecule scaffold

Formula: C₁₂H₉N₃S

Purity: Min. 95%

Molecular weight: 227.29 g/mol

Ref: 3D-BBB04273