CAS 65105-52-4
:Strobilurin B
Description:
Strobilurin B is a natural compound classified as a fungicide, belonging to the strobilurin class of chemicals, which are derived from the fungus Strobilurus tenacellus. It exhibits broad-spectrum antifungal activity, making it effective against various plant pathogens. The compound functions by inhibiting mitochondrial respiration in fungi, specifically targeting the cytochrome bc1 complex, which disrupts energy production and ultimately leads to cell death. Strobilurin B is characterized by its relatively low toxicity to mammals and beneficial organisms, which makes it a preferred choice in agricultural applications. It is typically used in crop protection to manage diseases in cereals, fruits, and vegetables. Additionally, Strobilurin B has been studied for its potential in enhancing plant growth and yield, as it may also stimulate certain physiological processes in plants. Its stability and effectiveness under various environmental conditions contribute to its utility in integrated pest management strategies. However, as with all pesticides, careful consideration of resistance management and environmental impact is essential when using Strobilurin B.
Formula:C17H19ClO4
InChI:InChI=1S/C17H19ClO4/c1-12(14(11-20-2)17(19)22-4)6-5-7-13-8-9-15(18)16(10-13)21-3/h5-11H,1-4H3/b7-5+,12-6-,14-11+
InChI key:InChIKey=ZDIQYKMDNQULMX-PJUQCDRASA-N
SMILES:C(=C/C=C(\C(\C(OC)=O)=C/OC)/C)\C1=CC(OC)=C(Cl)C=C1
Synonyms:- Strobilurin B
- 3,5-Hexadienoic acid, 6-(4-chloro-3-methoxyphenyl)-2-(methoxymethylene)-3-methyl-, methyl ester, (E,Z,E)-
- 3,5-Hexadienoic acid, 6-(4-chloro-3-methoxyphenyl)-2-(methoxymethylene)-3-methyl-, methyl ester, (2E,3Z,5E)-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

