CymitQuimica logo

CAS 651059-70-0

:

methyl 2-methyloxazole-5-carboxylate

Description:
Methyl 2-methyloxazole-5-carboxylate is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. This compound features a carboxylate functional group, contributing to its acidic properties, and a methyl group that enhances its hydrophobic characteristics. Typically, it appears as a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the methyl group and the carboxylate moiety can influence its reactivity, making it useful in various synthetic applications, particularly in the field of medicinal chemistry and organic synthesis. Its solubility in organic solvents and moderate stability under standard conditions make it a versatile intermediate in chemical reactions. Additionally, the compound may exhibit biological activity, which can be explored for potential pharmaceutical applications. As with many organic compounds, safety precautions should be taken when handling methyl 2-methyloxazole-5-carboxylate, including the use of appropriate personal protective equipment.
Formula:C6H7NO3
InChI:InChI=1/C6H7NO3/c1-4-7-3-5(10-4)6(8)9-2/h3H,1-2H3
InChI key:HCQUYIDTEHMXQS-UHFFFAOYSA-N
SMILES:Cc1ncc(C(=O)OC)o1
Synonyms:
  • 5-Oxazolecarboxylic acid, 2-methyl-, methyl ester
  • Methyl 2-methyl-1,3-oxazole-5-carboxylate
Found 4 products.