CAS 65117-30-8

(2R)-2-chloro-N,N-dimethyl-2-phenylethanamide

Description:

(2R)-2-chloro-N,N-dimethyl-2-phenylethanamide, with the CAS number 65117-30-8, is an organic compound characterized by its amide functional group, which is derived from the reaction of an amine with a carboxylic acid. This compound features a chiral center at the second carbon, contributing to its stereochemistry, specifically the (2R) configuration. The presence of a chlorine atom at the second carbon enhances its reactivity and may influence its biological activity. The dimethyl groups attached to the nitrogen atom indicate that it is a tertiary amide, which can affect its solubility and interaction with other molecules. The phenyl group contributes to the compound's hydrophobic character and can influence its binding properties in biological systems. Overall, this compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, boiling point, and solubility, would require empirical data for precise values.

Formula: C₁₀H₁₂ClNO

InChI: InChI=1/C10H12ClNO/c1-12(2)10(13)9(11)8-6-4-3-5-7-8/h3-7,9H,1-2H3/t9-/m1/s1

SMILES: CN(C)C(=O)[C@@H](c1ccccc1)Cl

2-Chloro-N,N-dimethyl-2-phenylacetamide

CAS: 65117-30-8

Versatile small molecule scaffold

Formula: C₁₀H₁₂ClNO

Purity: Min. 95%

Molecular weight: 197.66 g/mol

Ref: 3D-QCA11730