CAS 65128-68-9

2-Hydrazinylthiazolo[4,5-c]pyridine

Description:

2-Hydrazinylthiazolo[4,5-c]pyridine is a heterocyclic compound characterized by the presence of both a thiazole and a pyridine ring, along with a hydrazine functional group. This compound typically exhibits properties associated with its nitrogen-containing functional groups, such as potential reactivity in various chemical reactions, including nucleophilic substitutions and condensation reactions. The thiazole ring contributes to its aromatic character, while the hydrazine moiety can participate in redox reactions and may exhibit biological activity. The compound's structure suggests it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both nitrogen and sulfur atoms, which can influence biological interactions. Additionally, its unique structural features may confer specific electronic properties, making it of interest in materials science and organic synthesis. As with many heterocycles, the solubility and stability of 2-Hydrazinylthiazolo[4,5-c]pyridine can vary depending on the solvent and environmental conditions.

Formula: C₆H₆N₄S

InChI: InChI=1S/C6H6N4S/c7-10-6-9-4-3-8-2-1-5(4)11-6/h1-3H,7H2,(H,9,10)

InChI key: InChIKey=UURRSHHHLAFOIP-UHFFFAOYSA-N

SMILES: N(N)=C1NC=2C(S1)=CC=NC2

Synonyms:

• Thiazolo[4,5-c]pyridine, 2-hydrazinyl-
• 1-(Thiazolo[4,5-c]pyridin-2-yl)hydrazine
• 2-Hydrazinylthiazolo[4,5-c]pyridine
• 2-Hydrazinothiazolo[4,5-c]pyridine
• Thiazolo[4,5-c]pyridin-2(3H)-one, hydrazone

{[1,3]Thiazolo[4,5-c]pyridin-2-yl}hydrazine

CAS: 65128-68-9

Versatile small molecule scaffold

Formula: C₆H₆N₄S

Purity: Min. 95%

Molecular weight: 166.21 g/mol

Ref: 3D-QCA12868