CAS 65145-13-3
:2-Fluoro-4-hydroxybenzoic acid
Description:
2-Fluoro-4-hydroxybenzoic acid is an aromatic compound characterized by the presence of a fluorine atom and a hydroxyl group on a benzoic acid framework. Its molecular structure features a fluorine substituent at the ortho position and a hydroxyl group at the para position relative to the carboxylic acid group. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the hydroxyl group, which can engage in hydrogen bonding. The fluorine atom can influence the compound's reactivity and biological activity, often enhancing lipophilicity and altering the electronic properties of the molecule. 2-Fluoro-4-hydroxybenzoic acid may be utilized in various applications, including pharmaceuticals and agrochemicals, due to its potential as an intermediate in organic synthesis. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on purity and environmental conditions. As with many chemical substances, safety precautions should be observed when handling this compound, as it may pose health risks.
Formula:C7H5FO3
InChI:InChI=1/C7H5FO3/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3,9H,(H,10,11)
InChI key:InChIKey=NXWTWYULZRDBSA-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(F)C=C(O)C=C1
Synonyms:- 2-Fluoro-4-hydroxybenzoicacid
- 4-Hydroxy-2-fluorobenzoic acid
- Benzoic acid, 2-fluoro-4-hydroxy-
- Qvr Dq Bf
- Rarechem Al Bo 0814
- 2-Fluoro-4-hydroxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzoic acid, 2-fluoro-4-hydroxy-
CAS:Formula:C7H5FO3Purity:98%Color and Shape:SolidMolecular weight:156.11122-Fluoro-4-hydroxybenzoic Acid
CAS:Formula:C7H5FO3Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:156.112-Fluoro-4-hydroxybenzoic acid
CAS:2-Fluoro-4-hydroxybenzoic acidFormula:C7H5FO3Purity:98%Color and Shape: beige solidMolecular weight:156.11g/mol2-Fluoro-4-hydroxybenzoic acid
CAS:The 2-fluoro-4-hydroxybenzoic acid (2F4HB) is a naturally occurring substance that has been synthesized by the process of carbon source. It is a member of the class of compounds known as flavonoids, which are found in plants and have many functions such as being an antioxidant, having anti-inflammatory properties, and being a precursor to vitamin K. The 2F4HB has been shown to have antimicrobial activity against various bacterial species including C. parapsilosis and B. cereus, with inhibitory effects on cell growth. This compound also has been shown to have birefringence properties under polarized light microscopy. It may be used as a fluorescent dye to study the structure of polymers or other organic substances that can be dissolved in water or organic solvents. The 2F4HB also shows potential as an electron spin resonance agent for magnetic resonance spectroscopy because it can act as a free radical scavengerFormula:C7H5FO3Purity:Min. 95%Molecular weight:156.11 g/mol2-Fluoro-4-hydroxybenzoic acid
CAS:Formula:C7H5FO3Purity:98%Color and Shape:SolidMolecular weight:156.112





