CAS 65147-16-2
:5-[{(2S)-1-[(aminoacetyl)amino]-5-[(diaminomethylidene)amino]-1-oxopentan-2-yl}(4-methyl-2-oxo-2H-chromen-7-yl)amino]-5-oxopentanoic acid
Description:
The chemical substance known as "5-[{(2S)-1-[(aminoacetyl)amino]-5-[(diaminomethylidene)amino]-1-oxopentan-2-yl}(4-methyl-2-oxo-2H-chromen-7-yl)amino]-5-oxopentanoic acid," with the CAS number 65147-16-2, is a complex organic compound characterized by its multi-functional structure. It features a pentanoic acid backbone with multiple amino groups, indicating potential for biological activity, particularly in peptide synthesis or as a pharmaceutical intermediate. The presence of a chromen-7-yl moiety suggests that it may exhibit properties associated with flavonoids, such as antioxidant activity. The compound's structure includes both oxo and amino functional groups, which can influence its solubility, reactivity, and interaction with biological systems. Its stereochemistry, indicated by the (2S) configuration, may also play a crucial role in its biological activity and interactions. Overall, this compound's intricate structure positions it as a candidate for further research in medicinal chemistry and biochemistry.
Formula:C23H30N6O7
InChI:InChI=1/C23H30N6O7/c1-13-10-21(34)36-17-11-14(7-8-15(13)17)29(19(31)5-2-6-20(32)33)16(4-3-9-27-23(25)26)22(35)28-18(30)12-24/h7-8,10-11,16H,2-6,9,12,24H2,1H3,(H,32,33)(H4,25,26,27)(H,28,30,35)/t16-/m0/s1
SMILES:Cc1cc(=O)oc2cc(ccc12)N([C@@H](CCCNC(=N)N)C(=O)N=C(CN)O)C(=O)CCCC(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Glutaryl-Gly-Arg-AMC
CAS:Glt-GR-AMC, sensitive fluorogenic substrate for urokinase and tissue-type plasminogen activator.Formula:C23H30N6O7Color and Shape:WhiteMolecular weight:502.53Glutaryl-Gly-Arg-AMC hydrochloride salt
CAS:<p>Glutaryl-Gly-Arg-AMC hydrochloride salt is a high quality, fine chemical reagent that is useful as a building block, scaffold or intermediate. It has been used in the synthesis of other complex compounds and has been shown to have potential for use in drug discovery research. Glutaryl-Gly-Arg-AMC hydrochloride salt is a versatile building block that can be used in reactions that require the presence of an amine group, such as peptide coupling. This reagent can also be used to modify the functional groups on small molecules, such as aldehydes and carboxylic acids. Glutaryl-Gly-Arg-AMC hydrochloride salt is also useful as a reaction component in the synthesis of speciality chemicals, such as pharmaceuticals and agrochemicals.</p>Formula:C23H30N6O7•HClPurity:Min. 95 Area-%Color and Shape:PowderMolecular weight:538.98 g/molGlt-Gly-Arg-MCA
CAS:<p>Glt-Gly-Arg-MCA is a research tool that is used to activate the GLT1 receptor. It binds to the GLT1 receptor and activates it by binding to the Ligand-binding site. Glt-Gly-Arg-MCA has been shown to be an inhibitor of ion channels, such as Na+ channels, K+ channels, Ca2+ channels and voltage-gated Ca2+ channels. This product also binds to antibody molecules and inhibits their ability to bind with antigens or receptors. Glt-Gly-Arg-MCA has been used in research for Cell Biology, Pharmacology, and Life Science.</p>Formula:C23H30N6O7Purity:Min. 95%Molecular weight:502.52 g/mol

