CAS 65147-90-2

6-Bromo-2-(3-pyridinyl)-3H-imidazo[4,5-b]pyridine

Description:

6-Bromo-2-(3-pyridinyl)-3H-imidazo[4,5-b]pyridine is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both imidazole and pyridine rings. This compound features a bromine substituent at the 6-position and a pyridine moiety at the 2-position, contributing to its unique chemical properties. It is typically a solid at room temperature and exhibits moderate solubility in organic solvents. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in organic synthesis and medicinal chemistry. The compound may exhibit biological activity, potentially acting as a ligand or inhibitor in various biochemical pathways, which is of interest in drug development. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in biological systems. As with many heterocycles, it may also display fluorescence properties, making it useful in analytical applications. Safety and handling precautions should be observed due to the presence of bromine and its potential biological effects.

Formula: C₁₁H₇BrN₄

InChI: InChI=1S/C11H7BrN4/c12-8-4-9-11(14-6-8)16-10(15-9)7-2-1-3-13-5-7/h1-6H,(H,14,15,16)

InChI key: InChIKey=HAJPVWOPPVBQAB-UHFFFAOYSA-N

SMILES: BrC=1C=C2NC(=NC2=NC1)C=3C=CC=NC3

Synonyms:

• 6-Bromo-2-(3-pyridinyl)-3H-imidazo[4,5-b]pyridine
• 1H-Imidazo[4,5-b]pyridine, 6-bromo-2-(3-pyridinyl)-
• 3H-Imidazo[4,5-b]pyridine, 6-bromo-2-(3-pyridinyl)-

3-{6-Bromo-3H-imidazo[4,5-b]pyridin-2-yl}pyridine

CAS: 65147-90-2

Versatile small molecule scaffold

Formula: C₁₁H₇BrN₄

Purity: Min. 95%

Molecular weight: 275.1 g/mol

Ref: 3D-QCA14790