CAS 6515-37-3
:4'-Hydroxyflavanone
Description:
4'-Hydroxyflavanone, with the CAS number 6515-37-3, is a flavonoid compound characterized by its flavanone structure, which consists of a chromone backbone with a hydroxyl group at the 4' position of the phenyl ring. This compound typically exhibits a yellow to orange color, which is common among flavonoids due to their conjugated double bond systems that allow for light absorption. It is known for its potential antioxidant properties, which can contribute to various biological activities, including anti-inflammatory and anti-cancer effects. 4'-Hydroxyflavanone is soluble in organic solvents like ethanol and methanol but has limited solubility in water. Its chemical formula reflects the presence of multiple hydroxyl groups, which enhance its reactivity and interaction with other biological molecules. This compound is of interest in both pharmaceutical and nutritional research due to its potential health benefits and applications in functional foods. Additionally, it may serve as a precursor for the synthesis of other bioactive compounds in the flavonoid family.
Formula:C15H12O3
InChI:InChI=1/C15H12O3/c16-11-7-5-10(6-8-11)15-9-13(17)12-3-1-2-4-14(12)18-15/h1-8,15-16H,9H2
InChI key:InChIKey=ZLHVIYHWWQYJID-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)C(=O)CC(c1ccc(cc1)O)O2
Synonyms:- 2,3-Dihydro-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one
- 2-(4-Hydroxyphenyl)-2,3-dihydrochromen-4-one
- 2-(4-Hydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-4-one
- 2-(4-Hydroxyphenyl)chroman-4-one
- 2-(4-hydroxyphenyl)-2,3-dihydro-4H-chromen-4-one
- 4H-1-Benzopyran-4-one, 2,3-dihydro-2-(4-hydroxyphenyl)-
- Flavanone, 4'-hydroxy-
- Stx 310
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
4'-Hydroxyflavanone
CAS:Formula:C15H12O3Purity:>98.0%(HPLC)Color and Shape:Very Pale Yellow - Reddish Yellow SolidMolecular weight:240.264'-Hydroxyflavanone
CAS:4'-Hydroxyflavanone analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C15H12O3Purity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:240.274-Hydroxyflavanone
CAS:4-Hydroxyflavanone is a natural product, shows full vasorelaxing effects
Formula:C15H12O3Purity:97.99%Color and Shape:SolidMolecular weight:240.254'-Hydroxyflavanone
CAS:4'-Hydroxyflavanone is a naturally occurring flavonoid compound, which is derived from plant sources, particularly citrus fruits and other types of vegetation. The compound is characterized by its phenolic structure, which plays a significant role in its biological activity. 4'-Hydroxyflavanone exhibits its mode of action primarily through antioxidant activity, which involves scavenging reactive oxygen species and thus protecting cells from oxidative stress.Formula:C15H12O3Purity:Min. 95%Color and Shape:PowderMolecular weight:240.25 g/mol4'-Hydroxyflavanone
CAS:Controlled ProductApplications 4'-Hydroxyflavanone (cas# 6515-37-3) could be a useful antitumor agent, specifically studied as a strong aromatase inhibitor against estrogen-dependent breast cancer.
References Kizilcan, D. S., et al.: Struct. Chem., 31, 1339 (2020)Formula:C15H12O3Color and Shape:NeatMolecular weight:240.25








