CAS 65156-70-9

2-butyl-5-methyl-2,4-dihydro-3H-pyrazol-3-one

Description:

2-butyl-5-methyl-2,4-dihydro-3H-pyrazol-3-one is an organic compound characterized by its pyrazolone structure, which features a five-membered ring containing two nitrogen atoms. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents. Its molecular structure includes a butyl group and a methyl group, contributing to its hydrophobic characteristics. The presence of the pyrazolone moiety suggests potential applications in pharmaceuticals, agrochemicals, or as a chemical intermediate due to its ability to participate in various chemical reactions, such as condensation and cyclization. Additionally, compounds of this class may exhibit biological activity, including anti-inflammatory or analgesic properties, although specific biological data for this compound may vary. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 2-butyl-5-methyl-2,4-dihydro-3H-pyrazol-3-one represents a versatile compound within organic chemistry with potential applications in various fields.

Formula: C₈H₁₄N₂O

InChI: InChI=1/C8H14N2O/c1-3-4-5-10-8(11)6-7(2)9-10/h3-6H2,1-2H3

SMILES: CCCCN1C(=O)CC(=N1)C