CAS 65156-94-7

5-chloro-1H-pyrrolo[3,2-b]pyridine

Description:

5-Chloro-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 5-position of the pyrrolo ring enhances its reactivity and potential for substitution reactions. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents, making it useful in various chemical applications. Its structure allows for potential interactions with biological systems, which has garnered interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may also exhibit interesting electronic properties due to the conjugated system formed by the fused rings. Additionally, it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in organic synthesis. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.

Formula: C₇H₅ClN₂

InChI: InChI=1/C7H5ClN2/c8-7-2-1-5-6(10-7)3-4-9-5/h1-4,9H

SMILES: c1cc(Cl)nc2cc[nH]c12

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridine, 5-chloro-
• 5-Chloro-4-azaindole
• 5-chloro-1h-pyrrolo[3,2-b] pyridine

5-Chloro-1H-pyrrolo[3,2-b]pyridine

CAS: 65156-94-7

Formula: C₇H₅ClN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 152.5810

Ref: IN-DA0038K6

5-Chloro-1H-pyrrolo[3,2-b]pyridine

CAS: 65156-94-7

5-Chloro-1H-pyrrolo[3,2-b]pyridine

Purity: 97%

Molecular weight: 152.58g/mol

Ref: 54-OR480796

5-Chloro-1H-pyrrolo[3,2-b]pyridine

CAS: 65156-94-7

Formula: C₇H₅ClN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 152.58

Ref: 10-F043523