CAS 65165-14-2

N-methyl-2,2'-imino-bis(8-hydroxy-quinoline)

Description:

N-methyl-2,2'-imino-bis(8-hydroxy-quinoline), with the CAS number 65165-14-2, is a chemical compound characterized by its unique structure that includes two 8-hydroxyquinoline moieties linked by an imino group. This compound exhibits chelating properties, allowing it to form stable complexes with metal ions, which is particularly useful in various applications such as analytical chemistry and materials science. The presence of the hydroxyl groups enhances its solubility in polar solvents and contributes to its ability to participate in hydrogen bonding. Additionally, the methyl group attached to the imino nitrogen can influence the compound's electronic properties and reactivity. N-methyl-2,2'-imino-bis(8-hydroxy-quinoline) may also exhibit biological activity, making it of interest in medicinal chemistry. Its stability, solubility, and chelating ability are key characteristics that define its potential uses in various fields, including coordination chemistry and as a ligand in metal ion detection and extraction processes.

Formula: C₁₉H₁₅N₃O₂

InChI: InChI=1/C19H15N3O2/c1-22(16-10-8-12-4-2-6-14(23)18(12)20-16)17-11-9-13-5-3-7-15(24)19(13)21-17/h2-11,23-24H,1H3

SMILES: CN(c1ccc2cccc(c2n1)O)c1ccc2cccc(c2n1)O

Synonyms:

• N-Methyl-2,2-imino-di(8-quinolinol)
• 2,2'-(Methylimino)Diquinolin-8-Ol

2,2'-(Methylimino)diquinolin-8-ol

CAS: 65165-14-2

Please enquire for more information about 2,2'-(Methylimino)diquinolin-8-ol including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₉H₁₅N₃O₂

Purity: Min. 95%

Molecular weight: 317.34 g/mol

Ref: 3D-FM130041