CAS 65167-83-1
:8-[3-(oct-2-en-1-yl)oxiran-2-yl]octanoic acid
Description:
8-[3-(Oct-2-en-1-yl)oxiran-2-yl]octanoic acid, with the CAS number 65167-83-1, is a chemical compound characterized by its unique structure that includes an octanoic acid backbone and an epoxide functional group. The presence of the oct-2-en-1-yl substituent introduces a double bond, contributing to its reactivity and potential applications in organic synthesis. This compound is likely to exhibit properties typical of fatty acids, such as being amphiphilic, which allows it to interact with both hydrophilic and hydrophobic environments. The epoxide group may also impart specific reactivity, making it useful in polymerization reactions or as a precursor in the synthesis of more complex molecules. Additionally, the compound's structure suggests potential applications in the fields of surfactants, emulsifiers, or as intermediates in the production of specialty chemicals. Its stability, solubility, and reactivity would depend on the specific conditions under which it is used, including temperature and the presence of catalysts or other reagents.
Formula:C18H32O3
InChI:InChI=1/C18H32O3/c1-2-3-4-5-7-10-13-16-17(21-16)14-11-8-6-9-12-15-18(19)20/h7,10,16-17H,2-6,8-9,11-15H2,1H3,(H,19,20)
SMILES:CCCCCC=CCC1C(CCCCCCCC(=O)O)O1
Synonyms:- 2-Oxiraneoctanoic Acid, 3-(2-Octen-1-Yl)-
- 8-[3-(Oct-2-en-1-yl)oxiran-2-yl]octanoic acid
- 9,10-epoxy-12-octadecenoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
cis-9,10-Epoxy-12(Z)-octadecenoic acid
CAS:Formula:C18H32O3Purity:>98%Color and Shape:In solution, EthanolMolecular weight:296.45Cis-9,10-epoxy-12(Z)-octadecenoic acid
CAS:Cis-9,10-epoxy-12(Z)-octadecenoic acid is a fatty acid derivative, which is a specialized form of oxylipin. It is typically sourced from the enzymatic oxidation of linoleic acid, a common polyunsaturated fatty acid found in plant oils. This compound is characterized by its epoxidation at the 9,10 position and cis configuration, which confers distinct chemical properties compared to its non-epoxidized counterparts.
Formula:C18H32O3Purity:Min. 95%Molecular weight:296.4 g/mol

