CAS 65167-83-1

8-[3-(oct-2-en-1-yl)oxiran-2-yl]octanoic acid

Description:

8-[3-(Oct-2-en-1-yl)oxiran-2-yl]octanoic acid, with the CAS number 65167-83-1, is a chemical compound characterized by its unique structure that includes an octanoic acid backbone and an epoxide functional group. The presence of the oct-2-en-1-yl substituent introduces a double bond, contributing to its reactivity and potential applications in organic synthesis. This compound is likely to exhibit properties typical of fatty acids, such as being amphiphilic, which allows it to interact with both hydrophilic and hydrophobic environments. The epoxide group may also impart specific reactivity, making it useful in polymerization reactions or as a precursor in the synthesis of more complex molecules. Additionally, the compound's structure suggests potential applications in the fields of surfactants, emulsifiers, or as intermediates in the production of specialty chemicals. Its stability, solubility, and reactivity would depend on the specific conditions under which it is used, including temperature and the presence of catalysts or other reagents.

Formula: C₁₈H₃₂O₃

InChI: InChI=1/C18H32O3/c1-2-3-4-5-7-10-13-16-17(21-16)14-11-8-6-9-12-15-18(19)20/h7,10,16-17H,2-6,8-9,11-15H2,1H3,(H,19,20)

SMILES: CCCCCC=CCC1C(CCCCCCCC(=O)O)O1

Synonyms:

• 2-Oxiraneoctanoic Acid, 3-(2-Octen-1-Yl)-
• 8-[3-(Oct-2-en-1-yl)oxiran-2-yl]octanoic acid
• 9,10-epoxy-12-octadecenoic acid

cis-9,10-Epoxy-12(Z)-octadecenoic acid

CAS: 65167-83-1

Formula: C18H32O3

Purity: >98%

Color and Shape: In solution, Ethanol

Molecular weight: 296.45

Ref: 48-12-1864

Cis-9,10-epoxy-12(Z)-octadecenoic acid

CAS: 65167-83-1

Cis-9,10-epoxy-12(Z)-octadecenoic acid is a fatty acid derivative, which is a specialized form of oxylipin. It is typically sourced from the enzymatic oxidation of linoleic acid, a common polyunsaturated fatty acid found in plant oils. This compound is characterized by its epoxidation at the 9,10 position and cis configuration, which confers distinct chemical properties compared to its non-epoxidized counterparts.

Formula: C₁₈H₃₂O₃

Purity: Min. 95%

Molecular weight: 296.4 g/mol

Ref: 3D-QCA16783