CymitQuimica logo

CAS 651744-21-7

:

4-fluoro-1H-pyrrolo[2,3-b]pyridin-5-ol

Description:
4-Fluoro-1H-pyrrolo[2,3-b]pyridin-5-ol is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and pyridine fused together. The presence of a fluorine atom at the 4-position of the pyrrole ring and a hydroxyl group (-OH) at the 5-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and exhibits moderate solubility in polar solvents due to the hydroxyl group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the fluorine atom can enhance metabolic stability and bioavailability. Additionally, the compound may exhibit interesting electronic properties due to the conjugated system formed by the fused rings. Overall, 4-fluoro-1H-pyrrolo[2,3-b]pyridin-5-ol is of interest for further research in various fields, including drug discovery and materials science.
Formula:C7H5FN2O
InChI:InChI=1/C7H5FN2O/c8-6-4-1-2-9-7(4)10-3-5(6)11/h1-3,11H,(H,9,10)
InChI key:GBGMQCVLBKJRKN-UHFFFAOYSA-N
SMILES:c1cnc2c1c(c(c[nH]2)O)F
Synonyms:
  • 4-Fluor-1H-pyrrolo[2,3-b]pyridin-5-ol
  • 1H-Pyrrolo[2,3-b]pyridin-5-ol, 4-fluoro- (9CI)
  • 1H-Pyrrolo[2,3-b]pyridin-5-ol, 4-fluoro-
  • 4-fluoro-1H-pyrrolo[2,3-b]pyridin-5-ol
  • H-Pyrrolo[2,3-b]pyridin-5-ol, 4-fluoro- (9CI)
Found 3 products.