CAS 651744-22-8

4-fluoro-1-(tripropan-2-ylsilyl)-1H-pyrrolo[2,3-b]pyridin-5-ol

Description:

4-Fluoro-1-(tripropan-2-ylsilyl)-1H-pyrrolo[2,3-b]pyridin-5-ol is a chemical compound characterized by its complex structure, which includes a pyrrolopyridine core substituted with a fluorine atom and a tripropan-2-ylsilyl group. This compound features a pyrrole ring fused to a pyridine, contributing to its potential biological activity and interaction with various receptors. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, while the silyl group may provide protection for reactive functional groups or improve solubility in organic solvents. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its CAS number, 651744-22-8, allows for easy identification and retrieval of information in chemical databases. Overall, this compound exemplifies the intricate design often found in drug development, where modifications to molecular structure can significantly influence biological activity and pharmacokinetics.

Formula: C₁₆H₂₅FN₂OSi

InChI: InChI=1/C16H25FN2OSi/c1-10(2)21(11(3)4,12(5)6)19-8-7-13-15(17)14(20)9-18-16(13)19/h7-12,20H,1-6H3

SMILES: CC(C)[Si](C(C)C)(C(C)C)n1ccc2c(c(cnc12)O)F

Synonyms:

• 4-Fluor-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridin-5-ol
• 4-fluoro-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridin-5-ol

1H-Pyrrolo[2,3-b]pyridin-5-ol, 4-fluoro-1-[tris(1-methylethyl)silyl]-

CAS: 651744-22-8

Formula: C₁₆H₂₅FN₂OSi

Purity: 97%

Molecular weight: 308.4664

Ref: IN-DA00EY82

4-Fluoro-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridin-5-ol

CAS: 651744-22-8

4-Fluoro-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridin-5-ol

Purity: 97%

Molecular weight: 308.47g/mol

Ref: 54-PC1004181

4-fluoro-1-[tris(1-methylethyl)silyl]-1H-Pyrrolo[2,3-b]pyridin-5-ol

CAS: 651744-22-8

Purity: 97%

Molecular weight: 308.4719849

Ref: 10-F600221