CAS 65178-14-5

(1Z,3S)-3-({N-[(benzyloxy)carbonyl]-L-phenylalanyl}amino)-1-diazonio-4-phenylbut-1-en-2-olate

Description:

The chemical substance known as "(1Z,3S)-3-({N-[(benzyloxy)carbonyl]-L-phenylalanyl}amino)-1-diazonio-4-phenylbut-1-en-2-olate," with the CAS number 65178-14-5, is a complex organic compound characterized by its unique structural features. It contains a diazonium group, which is known for its reactivity and ability to participate in electrophilic aromatic substitution reactions. The presence of the benzyloxycarbonyl group indicates that it is likely used in peptide synthesis or as a protecting group for amino acids. The compound also features a phenylalanine derivative, suggesting potential applications in biochemistry or medicinal chemistry, particularly in the design of peptide-based drugs. Its stereochemistry, indicated by the (1Z,3S) configuration, implies specific spatial arrangements that can influence its biological activity and interactions. Overall, this compound exemplifies the intricate nature of organic molecules used in advanced chemical research and applications.

Formula: C₂₇H₂₆N₄O₄

InChI: InChI=1/C27H26N4O4/c28-29-18-25(32)23(16-20-10-4-1-5-11-20)30-26(33)24(17-21-12-6-2-7-13-21)31-27(34)35-19-22-14-8-3-9-15-22/h1-15,18,23-24H,16-17,19H2,(H2-,30,31,32,33,34)/b25-18-/t23-,24-/m0/s1

SMILES: c1ccc(cc1)C[C@@H](/C(=C/[N+]#N)/O)N=C([C@H](Cc1ccccc1)N=C([O-])OCc1ccccc1)O

Z-Phe-Phe-diazomethylketone

CAS: 65178-14-5

Z-FF-DMK, a cathepsin L-selective inhibitor.

Formula: C₂₇H₂₆N₄O₄

Purity: > 98%

Color and Shape: Yellow Powder

Molecular weight: 470.53

Ref: 01-4004026

Z-Phe-Phe-diazomethylketone

CAS: 65178-14-5

Z-Phe-Phe-diazomethylketone is a cathepsin inhibitor that has been shown to inhibit the proteolytic activity of various enzymes, including serine proteases and thrombotic thrombocytopenic. This compound inhibits the growth of Leishmania parasites in cell culture and has been shown to have a high affinity for carboxy terminal and proximal tubules. Z-Phe-Phe-diazomethylketone has a neutral pH, with an optimum at 7.0, which may be due to its ability to bind to proteins or other components of cells without affecting their functions.

Formula: C₂₇H₂₆N₄O₄

Purity: Min. 95%

Molecular weight: 470.52 g/mol

Ref: 3D-FP111009