CAS 65189-64-2
:L-tyrosyl-D-alanylglycyl-L-phenylalanyl-L-leucinamide
Description:
L-tyrosyl-D-alanylglycyl-L-phenylalanyl-L-leucinamide, with the CAS number 65189-64-2, is a synthetic peptide that consists of a sequence of amino acids, including L-tyrosine, D-alanine, glycine, L-phenylalanine, and L-leucine. This compound is characterized by its specific arrangement of amino acids, which contributes to its unique biochemical properties and potential biological activities. Peptides like this one are often studied for their roles in various physiological processes, including hormone regulation, neurotransmission, and immune responses. The presence of both L- and D-amino acids in its structure can influence its stability and interaction with biological systems, making it a subject of interest in pharmacology and medicinal chemistry. Additionally, the hydrophobic and hydrophilic characteristics of the amino acids in the sequence can affect the peptide's solubility and overall behavior in aqueous environments. Overall, L-tyrosyl-D-alanylglycyl-L-phenylalanyl-L-leucinamide represents a complex molecule with potential applications in research and therapeutic development.
Formula:C29H40N6O6
InChI:InChI=1/C29H40N6O6/c1-17(2)13-23(26(31)38)35-29(41)24(15-19-7-5-4-6-8-19)34-25(37)16-32-27(39)18(3)33-28(40)22(30)14-20-9-11-21(36)12-10-20/h4-12,17-18,22-24,36H,13-16,30H2,1-3H3,(H2,31,38)(H,32,39)(H,33,40)(H,34,37)(H,35,41)/t18-,22+,23+,24+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(D-Ala2)-Leu-Enkephalin amide
CAS:<p>Hyaluronic acid is a natural component of connective tissue and synovial fluid in animals. It is a linear, unbranched polysaccharide consisting of alternating D-glucuronic acid and N-acetyl-D-glucosamine. Hyaluronic acid has been shown to be useful in the treatment of long-term diseases such as heart disease or skin conditions like eczema. It is important for the efficient production of vaccines, which are used to prevent infectious diseases such as streptococcal infections. Hyaluronic acid can also be used as a microcontroller for minimally invasive procedures. This molecule can be used as an additive in the production of metallocene catalysts to increase the efficiency of these reactions, while reducing impurities during the process. The use of hyaluronic acid has been studied extensively, with many techniques employed to study its properties and functions. Genetic factors have also been found to play a role in</p>Formula:C29H40N6O6Purity:Min. 95%Molecular weight:568.66 g/mol
