
CAS 6519-27-3
:Isositsirikine
Description:
Isositsirikine, with the CAS number 6519-27-3, is a chemical compound that belongs to the class of alkaloids, which are naturally occurring organic compounds that mostly contain basic nitrogen atoms. Alkaloids are known for their diverse pharmacological effects and are often derived from plant sources. Isositsirikine is characterized by its specific molecular structure, which contributes to its biological activity. While detailed information on its properties may be limited, compounds in this category typically exhibit a range of effects, including potential therapeutic applications. Isositsirikine may be studied for its interactions with biological systems, including its potential effects on neurotransmitter systems or other physiological processes. As with many alkaloids, it is essential to handle Isositsirikine with care due to its potential biological activity and toxicity. Further research is necessary to fully understand its properties, mechanisms of action, and potential applications in medicine or pharmacology.
Formula:C21H26N2O3
InChI:InChI=1S/C21H26N2O3/c1-3-13-11-23-9-8-15-14-6-4-5-7-18(14)22-20(15)19(23)10-16(13)17(12-24)21(25)26-2/h3-7,16-17,19,22,24H,8-12H2,1-2H3/b13-3-/t16-,17-,19-/m0/s1
InChI key:InChIKey=RGXKJLTVROJBKZ-LZNZQLKFSA-N
SMILES:[C@H](C(OC)=O)(CO)[C@]/1(C[C@]2(C3=C(C=4C(N3)=CC=CC4)CCN2C\C1=C\C)[H])[H]
Synonyms:- 17,18-Secoyohimban-16-carboxylic acid, 19,20-didehydro-17-hydroxy-, methyl ester, (16R,19E)-
- Corynan-16-carboxylic acid, 19,20-didehydro-17-hydroxy-, methyl ester, (16R,19E)-
- Indolo[2,3-a]quinolizine-2-acetic acid, 3-ethylidene-1,2,3,4,6,7,12,12b-octahydro-α-(hydroxymethyl)-, methyl ester, (αR,2R,3E,12bS)-
- Isositsirikine
- 16R-Isositsirikine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(16R)-E-Isositsirikine
CAS:(16R)-E-Isositsirikine is a natural product for research related to life sciences. The catalog number is TN2653 and the CAS number is 6519-27-3.Formula:C21H26N2O3Purity:98%Color and Shape:SolidMolecular weight:354.44Methyl 2-[(12Br)-3-ethylidene-2,4,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-3-hydroxypropanoate
CAS:Methyl 2-[(12Br)-3-ethylidene-2,4,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-3-hydroxypropanoate is a complex bioactive compound that falls within the class of alkaloids. This compound is typically sourced from marine organisms, specifically certain species of sponge or tunicate, which are known to produce a variety of biologically active secondary metabolites. The mode of action of this compound involves interaction with specific cellular targets, potentially influencing signaling pathways or enzyme activity, which can lead to modulatory effects on biological processes.Formula:C21H26N2O3Purity:Min. 95%Molecular weight:354.4 g/mol


