CAS 65192-28-1
:(2Z)-3-hydroxy-2-(4-methoxyphenyl)prop-2-enal
Description:
(2Z)-3-hydroxy-2-(4-methoxyphenyl)prop-2-enal, also known by its CAS number 65192-28-1, is an organic compound characterized by its conjugated system, which includes an aldehyde functional group and a hydroxyl group. This compound features a prop-2-enal backbone with a methoxy-substituted phenyl group at the second carbon position, contributing to its aromatic properties. The presence of the hydroxyl group indicates potential for hydrogen bonding, which can influence its solubility and reactivity. The compound is likely to exhibit both polar and nonpolar characteristics due to the combination of the hydrophilic hydroxyl group and the hydrophobic methoxyphenyl moiety. Its structural configuration, particularly the Z (cis) arrangement of the double bond, can affect its stereochemistry and biological activity. Such compounds may be of interest in various fields, including medicinal chemistry and materials science, due to their potential applications in drug development and as intermediates in organic synthesis.
Formula:C10H10O3
InChI:InChI=1/C10H10O3/c1-13-10-4-2-8(3-5-10)9(6-11)7-12/h2-7,11H,1H3/b9-6+
Synonyms:- (2Z)-3-Hydroxy-2-(4-methoxyphenyl)acrylaldehyd
- (2Z)-3-Hydroxy-2-(4-methoxyphenyl)acrylaldehyde
- Benzeneacetaldehyde, alpha-(hydroxymethylene)-4-methoxy-, (alphaZ)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(4-METHOXYPHENYL)MALONDIALDEHYDE
CAS:Formula:C10H10O3Purity:95%Color and Shape:SolidMolecular weight:178.18462-(4-Methoxyphenyl)malonaldehyde
CAS:<p>2-(4-Methoxyphenyl)malonaldehyde</p>Formula:C10H10O3Purity:95%Color and Shape: pale yellow solidMolecular weight:178.18g/mol2-(4-Methoxyphenyl)malondialdehyde
CAS:Formula:C10H10O3Purity:95.0%Color and Shape:SolidMolecular weight:178.1872-(4-Methoxyphenyl)malondialdehyde
CAS:<p>2-(4-Methoxyphenyl)malondialdehyde is a synthetic chemical that is used as a reagent for the synthesis of piperidine derivatives. It can be readily prepared using hydrogen chloride and a hydrocarbon solvent in the presence of an acid catalyst. 2-(4-Methoxyphenyl)malondialdehyde has been used in the synthesis of bone morphogenetic proteins and other molecules, such as dorsomorphin and ldn-193189.</p>Formula:C10H10O3Purity:Min. 95%Molecular weight:178.18 g/mol



