CymitQuimica logo

CAS 65195-35-9

:

ethyl 4-aminopyrimidine-5-carboxylate

Description:
Ethyl 4-aminopyrimidine-5-carboxylate is an organic compound characterized by its pyrimidine ring structure, which features an amino group and a carboxylate ester functional group. This compound typically appears as a crystalline solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylate group. The amino group contributes to its basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Ethyl 4-aminopyrimidine-5-carboxylate is of interest in medicinal chemistry and pharmaceutical research, as derivatives of pyrimidine compounds often exhibit biological activity, including antimicrobial and anti-inflammatory properties. Its molecular structure allows for potential modifications that can enhance its pharmacological profile. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C7H9N3O2
InChI:InChI=1/C7H9N3O2/c1-2-12-7(11)5-3-9-4-10-6(5)8/h3-4H,2H2,1H3,(H2,8,9,10)
InChI key:OBBDJDIJXFWRJK-UHFFFAOYSA-N
SMILES:CCOC(=O)c1cnc[nH]c1=N
Synonyms:
  • 5-Pyrimidinecarboxylic Acid, 4-Amino-, Ethyl Ester
  • Ethyl 4-aminopyrimidine-5-carboxylate
Found 5 products.