CAS 652-78-8
:Gossypin
Description:
Gossypin, with the CAS number 652-78-8, is a flavonoid compound primarily derived from the cotton plant (Gossypium species). It is characterized by its yellow crystalline appearance and is known for its potential antioxidant properties. Gossypin exhibits a range of biological activities, including anti-inflammatory and antimicrobial effects, which have garnered interest in pharmacological research. The compound is soluble in organic solvents but has limited solubility in water, which is typical for many flavonoids. Its chemical structure features multiple hydroxyl groups, contributing to its reactivity and interaction with various biological systems. Gossypin has been studied for its potential health benefits, including its role in protecting cells from oxidative stress and its possible applications in developing natural therapeutic agents. However, further research is needed to fully understand its mechanisms of action and potential therapeutic uses. As with many natural compounds, the extraction and purification processes can influence its bioactivity and stability.
Formula:C21H20O13
InChI:InChI=1S/C21H20O13/c22-5-11-13(27)15(29)17(31)21(32-11)34-19-10(26)4-9(25)12-14(28)16(30)18(33-20(12)19)6-1-2-7(23)8(24)3-6/h1-4,11,13,15,17,21-27,29-31H,5H2/t11-,13-,15+,17-,21+/m1/s1
InChI key:InChIKey=SJRXVLUZMMDCNG-KKPQBLLMSA-N
SMILES:O(C1=C2C(C(=O)C(O)=C(O2)C3=CC(O)=C(O)C=C3)=C(O)C=C1O)[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O
Synonyms:- 2-(3,4-Dihydroxyphenyl)-8-(β-<span class="text-smallcaps">D</span>-glucopyranosyloxy)-3,5,7-trihydroxy-4H-1-benzopyran-4-one
- 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxo-4H-chromen-8-yl beta-D-allopyranoside
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-8-(β-<span class="text-smallcaps">D</span>-glucopyranosyloxy)-3,5,7-trihydroxy-
- Gossypetin 8-glucoside
- Gossypin
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-8-(β-D-glucopyranosyloxy)-3,5,7-trihydroxy-
- 2-(3,4-Dihydroxyphenyl)-8-(β-D-glucopyranosyloxy)-3,5,7-trihydroxy-4H-1-benzopyran-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
Gossypin
CAS:Gossypin analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C21H20O13Purity:(HPLC) ≥99%Color and Shape:PowderMolecular weight:480.38Gossypin
CAS:Formula:C21H20O13Purity:≥ 98.0%Color and Shape:Off-white to dark green-yellow powderMolecular weight:480.38Gossypin
CAS:<p>Gossypin</p>Formula:C21H20O13Purity:By hplc: 98.5% (Typical Value in Batch COA)Color and Shape: pale yellow powderMolecular weight:480.38g/molGossypin
CAS:Gossypin exhibits multiple medicinal properties and inhibits NF-kappaB, reducing inflammation, cancer growth, and angiogenesis.Formula:C21H20O13Purity:97.57% - 98.97%Color and Shape:SolidMolecular weight:480.38Gossypin
CAS:Natural glycosideFormula:C21H20O13Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:480.38Gossypin
CAS:<p>Gossypin is a flavonoid compound, which is a type of polyphenol found in various natural sources, such as plants. It is primarily isolated from the flowers of Hibiscus species. The mode of action of gossypin involves various biochemical pathways, including its role as a free-radical scavenger and modulator of several enzymes. It exhibits antioxidant, anti-inflammatory, and neuroprotective properties through interactions with cellular receptors and signaling pathways.</p>Formula:C21H20O13Color and Shape:Yellow PowderMolecular weight:480.38 g/mol
