CymitQuimica logo

CAS 65202-51-9

:

6-Bromo-3-pyridazinecarboxylic acid

Description:
6-Bromo-3-pyridazinecarboxylic acid is a heterocyclic organic compound characterized by the presence of a pyridazine ring, which is a six-membered aromatic ring containing two nitrogen atoms. The compound features a bromine substituent at the 6-position and a carboxylic acid functional group at the 3-position, contributing to its reactivity and potential applications in various chemical reactions. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The bromine atom can enhance the compound's electrophilic properties, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the presence of the carboxylic acid group allows for potential interactions in biological systems, which may be explored in medicinal chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C5H3BrN2O2
InChI:InChI=1S/C5H3BrN2O2/c6-4-2-1-3(5(9)10)7-8-4/h1-2H,(H,9,10)
InChI key:InChIKey=QYLYERSOVJIZLK-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(Br)N=N1
Synonyms:
  • 3-Bromopyridazine-6-carboxylic acid
  • 3-Pyridazinecarboxylic Acid, 6-Bromo-
  • 6-Bromopyridazine-3-carboxylic acid
  • 6-Bromo-3-pyridazinecarboxylic acid
Found 4 products.