CAS 65202-58-6

3-Bromo-6-methylpyridazine

Description:

3-Bromo-6-methylpyridazine is a heterocyclic organic compound characterized by a pyridazine ring, which consists of two adjacent nitrogen atoms in a six-membered ring. The presence of a bromine atom at the 3-position and a methyl group at the 6-position contributes to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its potential applications in pharmaceuticals and agrochemicals due to its reactivity and ability to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The bromine substituent can enhance the compound's reactivity, making it useful in synthetic organic chemistry. Additionally, 3-Bromo-6-methylpyridazine may exhibit biological activity, although specific biological properties would require further investigation. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns.

Formula: C₅H₅BrN₂

InChI: InChI=1S/C5H5BrN2/c1-4-2-3-5(6)8-7-4/h2-3H,1H3

InChI key: InChIKey=RACIHBXDZONTQJ-UHFFFAOYSA-N

SMILES: BrC1=CC=C(C)N=N1

Synonyms:

• Pyridazine, 3-bromo-6-methyl-
• 3-Bromo-6-methylpyridazine

3-Bromo-6-methylpyridazine

CAS: 65202-58-6

Formula: C₅H₅BrN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 173.0106

Ref: IN-DA0033MM

3-Bromo-6-methylpyridazine

CAS: 65202-58-6

3-Bromo-6-methylpyridazine

Purity: 98%

Molecular weight: 173.01g/mol

Ref: 54-OR905842

3-Bromo-6-methylpyridazine

CAS: 65202-58-6

Formula: C₅H₅BrN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 173.013

Ref: 10-F078224

3-Bromo-6-methylpyridazine

Controlled Product

CAS: 65202-58-6

Applications 3-Bromo-6-methylpyridazine is used as a reagent in the synthesis of piperazinyl quinolines as chemosensitizers to increase fluconazole susceptibility of Candida albicans. 3-Bromo-6-methylpyridazine is also used in the preparation of cyclohexyl fluoropyrimidinyl benzamides as CNS penetrable P2X7 receptor antagonists.
References Youngsaye, W., et al.: Bioorg. Med. Chem. Lett., 21, 5502 (2011); Chen, X., et al.: Bioorg. Med. Chem. Lett., 20, 3107 (2010)

Formula: C₅H₅BrN₂

Color and Shape: Neat

Molecular weight: 173.01

Ref: TR-B688315