CAS 65207-64-9
:2-amino-2,4,5-trideoxy-D-threo-pent-4-ynonic acid
Description:
2-Amino-2,4,5-trideoxy-D-threo-pent-4-ynonic acid, with the CAS number 65207-64-9, is a chemical compound that belongs to the class of amino sugars. It features a unique structure characterized by a pentynonic acid backbone, which includes a terminal alkyne group. This compound is notable for its amino group, which contributes to its reactivity and potential biological activity. The presence of hydroxyl groups and the specific stereochemistry (D-threo configuration) are significant for its interactions in biological systems. It is often studied for its role in carbohydrate metabolism and potential applications in medicinal chemistry, particularly in the development of antibiotics or other therapeutic agents. The compound's solubility, stability, and reactivity can be influenced by its functional groups, making it an interesting subject for research in organic and medicinal chemistry. Overall, 2-amino-2,4,5-trideoxy-D-threo-pent-4-ynonic acid exemplifies the complexity and diversity of amino sugars in biochemical pathways.
Formula:C5H7NO3
InChI:InChI=1/C5H7NO3/c1-2-3(7)4(6)5(8)9/h1,3-4,7H,6H2,(H,8,9)/t3-,4+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
L-β-Ethynylserine
CAS:<p>L-β-ethynylserine (βES), an analog of serine, efficiently incorporates into newly synthesized proteins. Its azido group facilitates coupling with fluorescent dyes or affinity tags, enabling protein enrichment or visualization.</p>Formula:C5H7NO3Color and Shape:SolidMolecular weight:129.11
