CymitQuimica logo

CAS 65214-86-0

:

Piperidine, 4-(diphenylmethoxy)-, hydrochloride (1:1)

Description:
Piperidine, 4-(diphenylmethoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a diphenylmethoxy group, which contributes to its unique properties and potential applications. As a hydrochloride salt, it is typically encountered in a solid form, enhancing its solubility in polar solvents, particularly water. The presence of the diphenylmethoxy moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound may exhibit various pharmacological activities, although specific biological effects would depend on its structure-activity relationship. Its CAS number, 65214-86-0, allows for easy identification in chemical databases. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure safe laboratory practices. Overall, this compound represents a blend of organic chemistry and potential therapeutic applications, warranting further investigation in research settings.
Formula:C18H21NO·ClH
InChI:InChI=1S/C18H21NO.ClH/c1-3-7-15(8-4-1)18(16-9-5-2-6-10-16)20-17-11-13-19-14-12-17;/h1-10,17-19H,11-14H2;1H
InChI key:InChIKey=HXROHDYGZFFVMO-UHFFFAOYSA-N
SMILES:C(OC1CCNCC1)(C2=CC=CC=C2)C3=CC=CC=C3.Cl
Synonyms:
  • Piperidine, 4-(diphenylmethoxy)-, hydrochloride (1:1)
  • Piperidine, 4-(diphenylmethoxy)-, hydrochloride
Found 9 products.